C31H31N5O — CID 11988836
(11R)-5-benzyl-8-methyl-4-[(4-phenylphenyl)methyl]-11-propan-2-yl-1,3,4,8,10-pentazatricyclo[7.3.0.02,6]dodeca-2,5,9-trien-7-one (PubChem CID 11988836) has the molecular formula C31H31N5O and a molecular weight of 489.62 g/mol. Its IUPAC name is (11R)-5-benzyl-8-methyl-4-[(4-phenylphenyl)methyl]-11-propan-2-yl-1,3,4,8,10-pentazatricyclo[7.3.0.02,6]dodeca-2,5,9-trien-7-one.
| Compound Name | (11R)-5-benzyl-8-methyl-4-[(4-phenylphenyl)methyl]-11-propan-2-yl-1,3,4,8,10-pentazatricyclo[7.3.0.02,6]dodeca-2,5,9-trien-7-one |
|---|---|
| PubChem CID | 11988836 |
| Molecular Formula | C31H31N5O |
| Molecular Weight | 489.62 g/mol |
| Exact Mass | 489.25 |
| IUPAC Name | (11R)-5-benzyl-8-methyl-4-[(4-phenylphenyl)methyl]-11-propan-2-yl-1,3,4,8,10-pentazatricyclo[7.3.0.02,6]dodeca-2,5,9-trien-7-one |
| SMILES | CC(C)[C@@H]1CN2C(=N1)N(C)C(=O)c1c2nn(Cc2ccc(-c3ccccc3)cc2)c1Cc1ccccc1 |
| InChI | InChI=1S/C31H31N5O/c1-21(2)26-20-35-29-28(30(37)34(3)31(35)32-26)27(18-22-10-6-4-7-11-22)36(33-29)19-23-14-16-25(17-15-23)24-12-8-5-9-13-24/h4-17,21,26H,18-20H2,1-3H3/t26-/m0/s1 |
| InChIKey | KZBJZBLKWSLVOS-SANMLTNESA-N |
| XLogP | 5.48 |
| TPSA | 53.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.62 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |