C19H24Cl2FN3O2 — CID 119888892
2-(4-aminophenyl)-1-[4-(4-fluoro-2-methoxyphenyl)piperazin-1-yl]ethanone;dihydrochloride (PubChem CID 119888892) has the molecular formula C19H24Cl2FN3O2 and a molecular weight of 416.32 g/mol. Its IUPAC name is 2-(4-aminophenyl)-1-[4-(4-fluoro-2-methoxyphenyl)piperazin-1-yl]ethanone;dihydrochloride.
| Compound Name | 2-(4-aminophenyl)-1-[4-(4-fluoro-2-methoxyphenyl)piperazin-1-yl]ethanone;dihydrochloride |
|---|---|
| PubChem CID | 119888892 |
| Molecular Formula | C19H24Cl2FN3O2 |
| Molecular Weight | 416.32 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | 2-(4-aminophenyl)-1-[4-(4-fluoro-2-methoxyphenyl)piperazin-1-yl]ethanone;dihydrochloride |
| SMILES | COc1cc(F)ccc1N1CCN(C(=O)Cc2ccc(N)cc2)CC1.Cl.Cl |
| InChI | InChI=1S/C19H22FN3O2.2ClH/c1-25-18-13-15(20)4-7-17(18)22-8-10-23(11-9-22)19(24)12-14-2-5-16(21)6-3-14;;/h2-7,13H,8-12,21H2,1H3;2*1H |
| InChIKey | QXGBQSBTBGEURT-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.32 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|