C51H54O7S — CID 11988951
(3R,4S,5S,6R)-2-[5-[(4-ethoxyphenyl)methyl]-2-methoxy-4-methylphenyl]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)thian-2-ol (PubChem CID 11988951) has the molecular formula C51H54O7S and a molecular weight of 811.05 g/mol. Its IUPAC name is (3R,4S,5S,6R)-2-[5-[(4-ethoxyphenyl)methyl]-2-methoxy-4-methylphenyl]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)thian-2-ol.
| Compound Name | (3R,4S,5S,6R)-2-[5-[(4-ethoxyphenyl)methyl]-2-methoxy-4-methylphenyl]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)thian-2-ol |
|---|---|
| PubChem CID | 11988951 |
| Molecular Formula | C51H54O7S |
| Molecular Weight | 811.05 g/mol |
| Exact Mass | 810.36 |
| IUPAC Name | (3R,4S,5S,6R)-2-[5-[(4-ethoxyphenyl)methyl]-2-methoxy-4-methylphenyl]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)thian-2-ol |
| SMILES | CCOc1ccc(Cc2cc(C3(O)S[C@H](COCc4ccccc4)[C@@H](OCc4ccccc4)[C@H](OCc4ccccc4)[C@H]3OCc3ccccc3)c(OC)cc2C)cc1 |
| InChI | InChI=1S/C51H54O7S/c1-4-55-44-27-25-38(26-28-44)30-43-31-45(46(53-3)29-37(43)2)51(52)50(58-35-42-23-15-8-16-24-42)49(57-34-41-21-13-7-14-22-41)48(56-33-40-19-11-6-12-20-40)47(59-51)36-54-32-39-17-9-5-10-18-39/h5-29,31,47-50,52H,4,30,32-36H2,1-3H3/t47-,48-,49+,50-,51?/m1/s1 |
| InChIKey | BQAXVNAYNSVVRU-PALZRNSMSA-N |
| XLogP | 10.23 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 811.05 |
| LogP ≤ 5 | 10.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |