C51H54O6S — CID 11988952
(2S,3R,4R,5S,6R)-2-[5-[(4-ethoxyphenyl)methyl]-2-methoxy-4-methylphenyl]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)thiane (PubChem CID 11988952) has the molecular formula C51H54O6S and a molecular weight of 795.05 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-2-[5-[(4-ethoxyphenyl)methyl]-2-methoxy-4-methylphenyl]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)thiane.
| Compound Name | (2S,3R,4R,5S,6R)-2-[5-[(4-ethoxyphenyl)methyl]-2-methoxy-4-methylphenyl]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)thiane |
|---|---|
| PubChem CID | 11988952 |
| Molecular Formula | C51H54O6S |
| Molecular Weight | 795.05 g/mol |
| Exact Mass | 794.36 |
| IUPAC Name | (2S,3R,4R,5S,6R)-2-[5-[(4-ethoxyphenyl)methyl]-2-methoxy-4-methylphenyl]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)thiane |
| SMILES | CCOc1ccc(Cc2cc([C@@H]3S[C@H](COCc4ccccc4)[C@@H](OCc4ccccc4)[C@H](OCc4ccccc4)C3OCc3ccccc3)c(OC)cc2C)cc1 |
| InChI | InChI=1S/C51H54O6S/c1-4-54-44-27-25-38(26-28-44)30-43-31-45(46(52-3)29-37(43)2)51-50(57-35-42-23-15-8-16-24-42)49(56-34-41-21-13-7-14-22-41)48(55-33-40-19-11-6-12-20-40)47(58-51)36-53-32-39-17-9-5-10-18-39/h5-29,31,47-51H,4,30,32-36H2,1-3H3/t47-,48-,49+,50?,51+/m1/s1 |
| InChIKey | ZUCWHADFWADLQL-PZOMXNIJSA-N |
| XLogP | 11.12 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 795.05 |
| LogP ≤ 5 | 11.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |