About 3-amino-N-(imidazo[1,2-a]pyridin-7-ylmethyl)propanamide
3-amino-N-(imidazo[1,2-a]pyridin-7-ylmethyl)propanamide (PubChem CID 119889538) has the molecular formula C11H14N4O
and a molecular weight of 218.26 g/mol. Its IUPAC name is 3-amino-N-(imidazo[1,2-a]pyridin-7-ylmethyl)propanamide.
Molecular Properties
| Compound Name | 3-amino-N-(imidazo[1,2-a]pyridin-7-ylmethyl)propanamide |
| PubChem CID | 119889538 |
| Molecular Formula | C11H14N4O |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | 3-amino-N-(imidazo[1,2-a]pyridin-7-ylmethyl)propanamide |
| SMILES | NCCC(=O)NCc1ccn2ccnc2c1 |
| InChI | InChI=1S/C11H14N4O/c12-3-1-11(16)14-8-9-2-5-15-6-4-13-10(15)7-9/h2,4-7H,1,3,8,12H2,(H,14,16) |
| InChIKey | YBYHPCXDSOBESG-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 72.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-amino-N-(imidazo[1,2-a]pyridin-7-ylmethyl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-N-(imidazo[1,2-a]pyridin-7-ylmethyl)propanamide?
The IUPAC name of 3-amino-N-(imidazo[1,2-a]pyridin-7-ylmethyl)propanamide (CID 119889538) is 3-amino-N-(imidazo[1,2-a]pyridin-7-ylmethyl)propanamide.
What is the SMILES notation for 3-amino-N-(imidazo[1,2-a]pyridin-7-ylmethyl)propanamide?
The canonical SMILES for 3-amino-N-(imidazo[1,2-a]pyridin-7-ylmethyl)propanamide is NCCC(=O)NCc1ccn2ccnc2c1.
What is the InChIKey of 3-amino-N-(imidazo[1,2-a]pyridin-7-ylmethyl)propanamide?
The InChIKey is YBYHPCXDSOBESG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N4O/c12-3-1-11(16)14-8-9-2-5-15-6-4-13-10(15)7-9/h2,4-7H,1,3,8,12H2,(H,14,16).
What are the key properties of 3-amino-N-(imidazo[1,2-a]pyridin-7-ylmethyl)propanamide?
3-amino-N-(imidazo[1,2-a]pyridin-7-ylmethyl)propanamide has a molecular weight of 218.26 g/mol, XLogP of 0.30, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-N-(imidazo[1,2-a]pyridin-7-ylmethyl)propanamide is sourced from PubChem (CID 119889538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).