C23H26ClF3N2O3S — CID 11988966
N-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-3-chloropropane-1-sulfonamide (PubChem CID 11988966) has the molecular formula C23H26ClF3N2O3S and a molecular weight of 502.99 g/mol. Its IUPAC name is N-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-3-chloropropane-1-sulfonamide.
| Compound Name | N-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-3-chloropropane-1-sulfonamide |
|---|---|
| PubChem CID | 11988966 |
| Molecular Formula | C23H26ClF3N2O3S |
| Molecular Weight | 502.99 g/mol |
| Exact Mass | 502.13 |
| IUPAC Name | N-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-3-chloropropane-1-sulfonamide |
| SMILES | O=S(=O)(CCCCl)NC[C@H]1CC[C@@H]2[C@H](O1)c1cc(C(F)(F)F)ccc1N[C@H]2c1ccccc1 |
| InChI | InChI=1S/C23H26ClF3N2O3S/c24-11-4-12-33(30,31)28-14-17-8-9-18-21(15-5-2-1-3-6-15)29-20-10-7-16(23(25,26)27)13-19(20)22(18)32-17/h1-3,5-7,10,13,17-18,21-22,28-29H,4,8-9,11-12,14H2/t17-,18+,21+,22+/m1/s1 |
| InChIKey | FKOAXPZYXONRMD-KSCDAYEDSA-N |
| XLogP | 5.26 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.99 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|