C30H28N6O — CID 11988967
(11R,15S)-5-anilino-8-methyl-4-[(4-phenylphenyl)methyl]-1,3,4,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2,5,9-trien-7-one (PubChem CID 11988967) has the molecular formula C30H28N6O and a molecular weight of 488.60 g/mol. Its IUPAC name is (11R,15S)-5-anilino-8-methyl-4-[(4-phenylphenyl)methyl]-1,3,4,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2,5,9-trien-7-one.
| Compound Name | (11R,15S)-5-anilino-8-methyl-4-[(4-phenylphenyl)methyl]-1,3,4,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2,5,9-trien-7-one |
|---|---|
| PubChem CID | 11988967 |
| Molecular Formula | C30H28N6O |
| Molecular Weight | 488.60 g/mol |
| Exact Mass | 488.23 |
| IUPAC Name | (11R,15S)-5-anilino-8-methyl-4-[(4-phenylphenyl)methyl]-1,3,4,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2,5,9-trien-7-one |
| SMILES | CN1C(=O)c2c(nn(Cc3ccc(-c4ccccc4)cc3)c2Nc2ccccc2)N2C1=N[C@@H]1CCC[C@@H]12 |
| InChI | InChI=1S/C30H28N6O/c1-34-29(37)26-27(31-23-11-6-3-7-12-23)35(33-28(26)36-25-14-8-13-24(25)32-30(34)36)19-20-15-17-22(18-16-20)21-9-4-2-5-10-21/h2-7,9-12,15-18,24-25,31H,8,13-14,19H2,1H3/t24-,25+/m1/s1 |
| InChIKey | DNWPSPOTOOQJAD-RPBOFIJWSA-N |
| XLogP | 5.52 |
| TPSA | 65.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.60 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |