C30H30N6O — CID 11988968
5-anilino-8,12,12-trimethyl-4-[(4-phenylphenyl)methyl]-1,3,4,8,10-pentazatricyclo[7.4.0.02,6]trideca-2,5,9-trien-7-one (PubChem CID 11988968) has the molecular formula C30H30N6O and a molecular weight of 490.61 g/mol. Its IUPAC name is 5-anilino-8,12,12-trimethyl-4-[(4-phenylphenyl)methyl]-1,3,4,8,10-pentazatricyclo[7.4.0.02,6]trideca-2,5,9-trien-7-one.
| Compound Name | 5-anilino-8,12,12-trimethyl-4-[(4-phenylphenyl)methyl]-1,3,4,8,10-pentazatricyclo[7.4.0.02,6]trideca-2,5,9-trien-7-one |
|---|---|
| PubChem CID | 11988968 |
| Molecular Formula | C30H30N6O |
| Molecular Weight | 490.61 g/mol |
| Exact Mass | 490.25 |
| IUPAC Name | 5-anilino-8,12,12-trimethyl-4-[(4-phenylphenyl)methyl]-1,3,4,8,10-pentazatricyclo[7.4.0.02,6]trideca-2,5,9-trien-7-one |
| SMILES | CN1C(=O)c2c(nn(Cc3ccc(-c4ccccc4)cc3)c2Nc2ccccc2)N2CC(C)(C)CN=C12 |
| InChI | InChI=1S/C30H30N6O/c1-30(2)19-31-29-34(3)28(37)25-26(32-24-12-8-5-9-13-24)36(33-27(25)35(29)20-30)18-21-14-16-23(17-15-21)22-10-6-4-7-11-22/h4-17,32H,18-20H2,1-3H3 |
| InChIKey | MNXHQSSGIULDQB-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 65.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.61 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |