C28H26N6O — CID 11988969
(11R)-5-anilino-8,11-dimethyl-4-[(4-phenylphenyl)methyl]-1,3,4,8,10-pentazatricyclo[7.3.0.02,6]dodeca-2,5,9-trien-7-one (PubChem CID 11988969) has the molecular formula C28H26N6O and a molecular weight of 462.56 g/mol. Its IUPAC name is (11R)-5-anilino-8,11-dimethyl-4-[(4-phenylphenyl)methyl]-1,3,4,8,10-pentazatricyclo[7.3.0.02,6]dodeca-2,5,9-trien-7-one.
| Compound Name | (11R)-5-anilino-8,11-dimethyl-4-[(4-phenylphenyl)methyl]-1,3,4,8,10-pentazatricyclo[7.3.0.02,6]dodeca-2,5,9-trien-7-one |
|---|---|
| PubChem CID | 11988969 |
| Molecular Formula | C28H26N6O |
| Molecular Weight | 462.56 g/mol |
| Exact Mass | 462.22 |
| IUPAC Name | (11R)-5-anilino-8,11-dimethyl-4-[(4-phenylphenyl)methyl]-1,3,4,8,10-pentazatricyclo[7.3.0.02,6]dodeca-2,5,9-trien-7-one |
| SMILES | C[C@@H]1CN2C(=N1)N(C)C(=O)c1c2nn(Cc2ccc(-c3ccccc3)cc2)c1Nc1ccccc1 |
| InChI | InChI=1S/C28H26N6O/c1-19-17-33-26-24(27(35)32(2)28(33)29-19)25(30-23-11-7-4-8-12-23)34(31-26)18-20-13-15-22(16-14-20)21-9-5-3-6-10-21/h3-16,19,30H,17-18H2,1-2H3/t19-/m1/s1 |
| InChIKey | RDTIPFRJCLQNJL-LJQANCHMSA-N |
| XLogP | 4.99 |
| TPSA | 65.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.56 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |