C21H26O6S — CID 11989083
(2S,3R,4R,5S,6R)-2-[5-[(4-ethoxyphenyl)methyl]-2-hydroxyphenyl]-6-(hydroxymethyl)thiane-3,4,5-triol (PubChem CID 11989083) has the molecular formula C21H26O6S and a molecular weight of 406.50 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-2-[5-[(4-ethoxyphenyl)methyl]-2-hydroxyphenyl]-6-(hydroxymethyl)thiane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S,6R)-2-[5-[(4-ethoxyphenyl)methyl]-2-hydroxyphenyl]-6-(hydroxymethyl)thiane-3,4,5-triol |
|---|---|
| PubChem CID | 11989083 |
| Molecular Formula | C21H26O6S |
| Molecular Weight | 406.50 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | (2S,3R,4R,5S,6R)-2-[5-[(4-ethoxyphenyl)methyl]-2-hydroxyphenyl]-6-(hydroxymethyl)thiane-3,4,5-triol |
| SMILES | CCOc1ccc(Cc2ccc(O)c([C@@H]3S[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c2)cc1 |
| InChI | InChI=1S/C21H26O6S/c1-2-27-14-6-3-12(4-7-14)9-13-5-8-16(23)15(10-13)21-20(26)19(25)18(24)17(11-22)28-21/h3-8,10,17-26H,2,9,11H2,1H3/t17-,18-,19+,20-,21+/m1/s1 |
| InChIKey | UOPBIEFIBACYKU-ADAARDCZSA-N |
| XLogP | 1.61 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.50 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |