C27H37F3N4O3S — CID 11989095
N-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-3-[2-(dimethylamino)ethylamino]propane-1-sulfonamide (PubChem CID 11989095) has the molecular formula C27H37F3N4O3S and a molecular weight of 554.68 g/mol. Its IUPAC name is N-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-3-[2-(dimethylamino)ethylamino]propane-1-sulfonamide.
| Compound Name | N-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-3-[2-(dimethylamino)ethylamino]propane-1-sulfonamide |
|---|---|
| PubChem CID | 11989095 |
| Molecular Formula | C27H37F3N4O3S |
| Molecular Weight | 554.68 g/mol |
| Exact Mass | 554.25 |
| IUPAC Name | N-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-3-[2-(dimethylamino)ethylamino]propane-1-sulfonamide |
| SMILES | CN(C)CCNCCCS(=O)(=O)NC[C@H]1CC[C@@H]2[C@H](O1)c1cc(C(F)(F)F)ccc1N[C@H]2c1ccccc1 |
| InChI | InChI=1S/C27H37F3N4O3S/c1-34(2)15-14-31-13-6-16-38(35,36)32-18-21-10-11-22-25(19-7-4-3-5-8-19)33-24-12-9-20(27(28,29)30)17-23(24)26(22)37-21/h3-5,7-9,12,17,21-22,25-26,31-33H,6,10-11,13-16,18H2,1-2H3/t21-,22+,25+,26+/m1/s1 |
| InChIKey | GZDOQHZLDQYWEZ-HRHCJDDBSA-N |
| XLogP | 4.17 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.68 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|