C24H30F3N3O3S — CID 11989097
N-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-3-(methylamino)propane-1-sulfonamide (PubChem CID 11989097) has the molecular formula C24H30F3N3O3S and a molecular weight of 497.58 g/mol. Its IUPAC name is N-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-3-(methylamino)propane-1-sulfonamide.
| Compound Name | N-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-3-(methylamino)propane-1-sulfonamide |
|---|---|
| PubChem CID | 11989097 |
| Molecular Formula | C24H30F3N3O3S |
| Molecular Weight | 497.58 g/mol |
| Exact Mass | 497.20 |
| IUPAC Name | N-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-3-(methylamino)propane-1-sulfonamide |
| SMILES | CNCCCS(=O)(=O)NC[C@H]1CC[C@@H]2[C@H](O1)c1cc(C(F)(F)F)ccc1N[C@H]2c1ccccc1 |
| InChI | InChI=1S/C24H30F3N3O3S/c1-28-12-5-13-34(31,32)29-15-18-9-10-19-22(16-6-3-2-4-7-16)30-21-11-8-17(24(25,26)27)14-20(21)23(19)33-18/h2-4,6-8,11,14,18-19,22-23,28-30H,5,9-10,12-13,15H2,1H3/t18-,19+,22+,23+/m1/s1 |
| InChIKey | WLOKZYFSYGUKNV-FUKQBSRTSA-N |
| XLogP | 4.24 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.58 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|