C23H28F3N3O3S — CID 11989098
N-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-3-aminopropane-1-sulfonamide (PubChem CID 11989098) has the molecular formula C23H28F3N3O3S and a molecular weight of 483.56 g/mol. Its IUPAC name is N-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-3-aminopropane-1-sulfonamide.
| Compound Name | N-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-3-aminopropane-1-sulfonamide |
|---|---|
| PubChem CID | 11989098 |
| Molecular Formula | C23H28F3N3O3S |
| Molecular Weight | 483.56 g/mol |
| Exact Mass | 483.18 |
| IUPAC Name | N-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-3-aminopropane-1-sulfonamide |
| SMILES | NCCCS(=O)(=O)NC[C@H]1CC[C@@H]2[C@H](O1)c1cc(C(F)(F)F)ccc1N[C@H]2c1ccccc1 |
| InChI | InChI=1S/C23H28F3N3O3S/c24-23(25,26)16-7-10-20-19(13-16)22-18(21(29-20)15-5-2-1-3-6-15)9-8-17(32-22)14-28-33(30,31)12-4-11-27/h1-3,5-7,10,13,17-18,21-22,28-29H,4,8-9,11-12,14,27H2/t17-,18+,21+,22+/m1/s1 |
| InChIKey | DUTIGEAYJXAQLA-KSCDAYEDSA-N |
| XLogP | 3.98 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.56 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |