C21H22ClF3N2O3S — CID 11989099
N-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-1-chloromethanesulfonamide (PubChem CID 11989099) has the molecular formula C21H22ClF3N2O3S and a molecular weight of 474.93 g/mol. Its IUPAC name is N-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-1-chloromethanesulfonamide.
| Compound Name | N-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-1-chloromethanesulfonamide |
|---|---|
| PubChem CID | 11989099 |
| Molecular Formula | C21H22ClF3N2O3S |
| Molecular Weight | 474.93 g/mol |
| Exact Mass | 474.10 |
| IUPAC Name | N-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-1-chloromethanesulfonamide |
| SMILES | O=S(=O)(CCl)NC[C@H]1CC[C@@H]2[C@H](O1)c1cc(C(F)(F)F)ccc1N[C@H]2c1ccccc1 |
| InChI | InChI=1S/C21H22ClF3N2O3S/c22-12-31(28,29)26-11-15-7-8-16-19(13-4-2-1-3-5-13)27-18-9-6-14(21(23,24)25)10-17(18)20(16)30-15/h1-6,9-10,15-16,19-20,26-27H,7-8,11-12H2/t15-,16+,19+,20+/m1/s1 |
| InChIKey | SZNMIFLBAKMTIK-LPWQTFTOSA-N |
| XLogP | 4.82 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.93 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|