C21H20F6N2O3S — CID 11989100
N-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-1,1,1-trifluoromethanesulfonamide (PubChem CID 11989100) has the molecular formula C21H20F6N2O3S and a molecular weight of 494.46 g/mol. Its IUPAC name is N-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-1,1,1-trifluoromethanesulfonamide.
| Compound Name | N-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-1,1,1-trifluoromethanesulfonamide |
|---|---|
| PubChem CID | 11989100 |
| Molecular Formula | C21H20F6N2O3S |
| Molecular Weight | 494.46 g/mol |
| Exact Mass | 494.11 |
| IUPAC Name | N-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-1,1,1-trifluoromethanesulfonamide |
| SMILES | O=S(=O)(NC[C@H]1CC[C@@H]2[C@H](O1)c1cc(C(F)(F)F)ccc1N[C@H]2c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C21H20F6N2O3S/c22-20(23,24)13-6-9-17-16(10-13)19-15(18(29-17)12-4-2-1-3-5-12)8-7-14(32-19)11-28-33(30,31)21(25,26)27/h1-6,9-10,14-15,18-19,28-29H,7-8,11H2/t14-,15+,18+,19+/m1/s1 |
| InChIKey | NQFDVJUIRRMNOR-PDWMJMLSSA-N |
| XLogP | 5.15 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.46 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |