C24H22F3N7O — CID 11989102
(11R,15S)-5-anilino-8-methyl-4-[[6-(trifluoromethyl)-3-pyridinyl]methyl]-1,3,4,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2,5,9-trien-7-one (PubChem CID 11989102) has the molecular formula C24H22F3N7O and a molecular weight of 481.48 g/mol. Its IUPAC name is (11R,15S)-5-anilino-8-methyl-4-[[6-(trifluoromethyl)-3-pyridinyl]methyl]-1,3,4,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2,5,9-trien-7-one.
| Compound Name | (11R,15S)-5-anilino-8-methyl-4-[[6-(trifluoromethyl)-3-pyridinyl]methyl]-1,3,4,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2,5,9-trien-7-one |
|---|---|
| PubChem CID | 11989102 |
| Molecular Formula | C24H22F3N7O |
| Molecular Weight | 481.48 g/mol |
| Exact Mass | 481.18 |
| IUPAC Name | (11R,15S)-5-anilino-8-methyl-4-[[6-(trifluoromethyl)-3-pyridinyl]methyl]-1,3,4,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2,5,9-trien-7-one |
| SMILES | CN1C(=O)c2c(nn(Cc3ccc(C(F)(F)F)nc3)c2Nc2ccccc2)N2C1=N[C@@H]1CCC[C@@H]12 |
| InChI | InChI=1S/C24H22F3N7O/c1-32-22(35)19-20(29-15-6-3-2-4-7-15)33(13-14-10-11-18(28-12-14)24(25,26)27)31-21(19)34-17-9-5-8-16(17)30-23(32)34/h2-4,6-7,10-12,16-17,29H,5,8-9,13H2,1H3/t16-,17+/m1/s1 |
| InChIKey | HLJDFQMSWCGSIM-SJORKVTESA-N |
| XLogP | 4.27 |
| TPSA | 78.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.48 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |