C25H22F4N6O — CID 11989103
(11R,15S)-5-anilino-4-[[3-fluoro-4-(trifluoromethyl)phenyl]methyl]-8-methyl-1,3,4,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2,5,9-trien-7-one (PubChem CID 11989103) has the molecular formula C25H22F4N6O and a molecular weight of 498.48 g/mol. Its IUPAC name is (11R,15S)-5-anilino-4-[[3-fluoro-4-(trifluoromethyl)phenyl]methyl]-8-methyl-1,3,4,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2,5,9-trien-7-one.
| Compound Name | (11R,15S)-5-anilino-4-[[3-fluoro-4-(trifluoromethyl)phenyl]methyl]-8-methyl-1,3,4,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2,5,9-trien-7-one |
|---|---|
| PubChem CID | 11989103 |
| Molecular Formula | C25H22F4N6O |
| Molecular Weight | 498.48 g/mol |
| Exact Mass | 498.18 |
| IUPAC Name | (11R,15S)-5-anilino-4-[[3-fluoro-4-(trifluoromethyl)phenyl]methyl]-8-methyl-1,3,4,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2,5,9-trien-7-one |
| SMILES | CN1C(=O)c2c(nn(Cc3ccc(C(F)(F)F)c(F)c3)c2Nc2ccccc2)N2C1=N[C@@H]1CCC[C@@H]12 |
| InChI | InChI=1S/C25H22F4N6O/c1-33-23(36)20-21(30-15-6-3-2-4-7-15)34(13-14-10-11-16(17(26)12-14)25(27,28)29)32-22(20)35-19-9-5-8-18(19)31-24(33)35/h2-4,6-7,10-12,18-19,30H,5,8-9,13H2,1H3/t18-,19+/m1/s1 |
| InChIKey | LWDVSPXMJVYPND-MOPGFXCFSA-N |
| XLogP | 5.02 |
| TPSA | 65.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.48 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |