C16H27Cl2N3OS — CID 119891756
N-[2-(4,5-dimethyl-1,3-thiazol-2-yl)ethyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;dihydrochloride (PubChem CID 119891756) has the molecular formula C16H27Cl2N3OS and a molecular weight of 380.39 g/mol. Its IUPAC name is N-[2-(4,5-dimethyl-1,3-thiazol-2-yl)ethyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;dihydrochloride.
| Compound Name | N-[2-(4,5-dimethyl-1,3-thiazol-2-yl)ethyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119891756 |
| Molecular Formula | C16H27Cl2N3OS |
| Molecular Weight | 380.39 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | N-[2-(4,5-dimethyl-1,3-thiazol-2-yl)ethyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;dihydrochloride |
| SMILES | Cc1nc(CCNC(=O)C2CC3CCCCC3N2)sc1C.Cl.Cl |
| InChI | InChI=1S/C16H25N3OS.2ClH/c1-10-11(2)21-15(18-10)7-8-17-16(20)14-9-12-5-3-4-6-13(12)19-14;;/h12-14,19H,3-9H2,1-2H3,(H,17,20);2*1H |
| InChIKey | WTOFPWGGGVMMTM-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.39 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |