About 2-(8-azabicyclo[3.2.1]octan-3-yl)-N-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]acetamide
2-(8-azabicyclo[3.2.1]octan-3-yl)-N-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]acetamide (PubChem CID 119891882) has the molecular formula C15H23N3OS
and a molecular weight of 293.44 g/mol. Its IUPAC name is 2-(8-azabicyclo[3.2.1]octan-3-yl)-N-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]acetamide.
Molecular Properties
| Compound Name | 2-(8-azabicyclo[3.2.1]octan-3-yl)-N-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]acetamide |
| PubChem CID | 119891882 |
| Molecular Formula | C15H23N3OS |
| Molecular Weight | 293.44 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | 2-(8-azabicyclo[3.2.1]octan-3-yl)-N-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]acetamide |
| SMILES | Cc1nc(C)c(CNC(=O)CC2CC3CCC(C2)N3)s1 |
| InChI | InChI=1S/C15H23N3OS/c1-9-14(20-10(2)17-9)8-16-15(19)7-11-5-12-3-4-13(6-11)18-12/h11-13,18H,3-8H2,1-2H3,(H,16,19) |
| InChIKey | QMADYGJXZXQBLH-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.44 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(8-azabicyclo[3.2.1]octan-3-yl)-N-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(8-azabicyclo[3.2.1]octan-3-yl)-N-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]acetamide?
The IUPAC name of 2-(8-azabicyclo[3.2.1]octan-3-yl)-N-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]acetamide (CID 119891882) is 2-(8-azabicyclo[3.2.1]octan-3-yl)-N-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]acetamide.
What is the SMILES notation for 2-(8-azabicyclo[3.2.1]octan-3-yl)-N-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]acetamide?
The canonical SMILES for 2-(8-azabicyclo[3.2.1]octan-3-yl)-N-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]acetamide is Cc1nc(C)c(CNC(=O)CC2CC3CCC(C2)N3)s1.
What is the InChIKey of 2-(8-azabicyclo[3.2.1]octan-3-yl)-N-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]acetamide?
The InChIKey is QMADYGJXZXQBLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23N3OS/c1-9-14(20-10(2)17-9)8-16-15(19)7-11-5-12-3-4-13(6-11)18-12/h11-13,18H,3-8H2,1-2H3,(H,16,19).
What are the key properties of 2-(8-azabicyclo[3.2.1]octan-3-yl)-N-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]acetamide?
2-(8-azabicyclo[3.2.1]octan-3-yl)-N-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]acetamide has a molecular weight of 293.44 g/mol, XLogP of 2.30, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(8-azabicyclo[3.2.1]octan-3-yl)-N-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]acetamide is sourced from PubChem (CID 119891882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).