C27H27F3N2O3S — CID 11989211
N-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-1-phenylmethanesulfonamide (PubChem CID 11989211) has the molecular formula C27H27F3N2O3S and a molecular weight of 516.59 g/mol. Its IUPAC name is N-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-1-phenylmethanesulfonamide.
| Compound Name | N-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-1-phenylmethanesulfonamide |
|---|---|
| PubChem CID | 11989211 |
| Molecular Formula | C27H27F3N2O3S |
| Molecular Weight | 516.59 g/mol |
| Exact Mass | 516.17 |
| IUPAC Name | N-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-1-phenylmethanesulfonamide |
| SMILES | O=S(=O)(Cc1ccccc1)NC[C@H]1CC[C@@H]2[C@H](O1)c1cc(C(F)(F)F)ccc1N[C@H]2c1ccccc1 |
| InChI | InChI=1S/C27H27F3N2O3S/c28-27(29,30)20-11-14-24-23(15-20)26-22(25(32-24)19-9-5-2-6-10-19)13-12-21(35-26)16-31-36(33,34)17-18-7-3-1-4-8-18/h1-11,14-15,21-22,25-26,31-32H,12-13,16-17H2/t21-,22+,25+,26+/m1/s1 |
| InChIKey | HJBMVPVQAXAVEM-HRHCJDDBSA-N |
| XLogP | 5.83 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.59 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |