C25H32F3N3O3S — CID 11989212
N-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-3-(dimethylamino)propane-1-sulfonamide (PubChem CID 11989212) has the molecular formula C25H32F3N3O3S and a molecular weight of 511.61 g/mol. Its IUPAC name is N-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-3-(dimethylamino)propane-1-sulfonamide.
| Compound Name | N-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-3-(dimethylamino)propane-1-sulfonamide |
|---|---|
| PubChem CID | 11989212 |
| Molecular Formula | C25H32F3N3O3S |
| Molecular Weight | 511.61 g/mol |
| Exact Mass | 511.21 |
| IUPAC Name | N-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-3-(dimethylamino)propane-1-sulfonamide |
| SMILES | CN(C)CCCS(=O)(=O)NC[C@H]1CC[C@@H]2[C@H](O1)c1cc(C(F)(F)F)ccc1N[C@H]2c1ccccc1 |
| InChI | InChI=1S/C25H32F3N3O3S/c1-31(2)13-6-14-35(32,33)29-16-19-10-11-20-23(17-7-4-3-5-8-17)30-22-12-9-18(25(26,27)28)15-21(22)24(20)34-19/h3-5,7-9,12,15,19-20,23-24,29-30H,6,10-11,13-14,16H2,1-2H3/t19-,20+,23+,24+/m1/s1 |
| InChIKey | WWGWRFLMANDVQN-SHBJFUFKSA-N |
| XLogP | 4.58 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.61 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |