C24H28ClF3N2O3S — CID 11989213
N-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-3-chloro-N-methylpropane-1-sulfonamide (PubChem CID 11989213) has the molecular formula C24H28ClF3N2O3S and a molecular weight of 517.01 g/mol. Its IUPAC name is N-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-3-chloro-N-methylpropane-1-sulfonamide.
| Compound Name | N-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-3-chloro-N-methylpropane-1-sulfonamide |
|---|---|
| PubChem CID | 11989213 |
| Molecular Formula | C24H28ClF3N2O3S |
| Molecular Weight | 517.01 g/mol |
| Exact Mass | 516.15 |
| IUPAC Name | N-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-3-chloro-N-methylpropane-1-sulfonamide |
| SMILES | CN(C[C@H]1CC[C@@H]2[C@H](O1)c1cc(C(F)(F)F)ccc1N[C@H]2c1ccccc1)S(=O)(=O)CCCCl |
| InChI | InChI=1S/C24H28ClF3N2O3S/c1-30(34(31,32)13-5-12-25)15-18-9-10-19-22(16-6-3-2-4-7-16)29-21-11-8-17(24(26,27)28)14-20(21)23(19)33-18/h2-4,6-8,11,14,18-19,22-23,29H,5,9-10,12-13,15H2,1H3/t18-,19+,22+,23+/m1/s1 |
| InChIKey | FCSPCVPSGCJQQP-FUKQBSRTSA-N |
| XLogP | 5.60 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.01 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|