C26H34F3N3O3S — CID 11989215
N-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-3-(dimethylamino)-N-methylpropane-1-sulfonamide (PubChem CID 11989215) has the molecular formula C26H34F3N3O3S and a molecular weight of 525.64 g/mol. Its IUPAC name is N-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-3-(dimethylamino)-N-methylpropane-1-sulfonamide.
| Compound Name | N-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-3-(dimethylamino)-N-methylpropane-1-sulfonamide |
|---|---|
| PubChem CID | 11989215 |
| Molecular Formula | C26H34F3N3O3S |
| Molecular Weight | 525.64 g/mol |
| Exact Mass | 525.23 |
| IUPAC Name | N-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-3-(dimethylamino)-N-methylpropane-1-sulfonamide |
| SMILES | CN(C)CCCS(=O)(=O)N(C)C[C@H]1CC[C@@H]2[C@H](O1)c1cc(C(F)(F)F)ccc1N[C@H]2c1ccccc1 |
| InChI | InChI=1S/C26H34F3N3O3S/c1-31(2)14-7-15-36(33,34)32(3)17-20-11-12-21-24(18-8-5-4-6-9-18)30-23-13-10-19(26(27,28)29)16-22(23)25(21)35-20/h4-6,8-10,13,16,20-21,24-25,30H,7,11-12,14-15,17H2,1-3H3/t20-,21+,24+,25+/m1/s1 |
| InChIKey | HILNUOLGGHNRLE-QKYMMTCKSA-N |
| XLogP | 4.92 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.64 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |