C22H31Cl2N3O3 — CID 119892786
N-[[2-(3-methoxyphenoxy)-3-pyridinyl]methyl]-3-piperidin-4-ylbutanamide;dihydrochloride (PubChem CID 119892786) has the molecular formula C22H31Cl2N3O3 and a molecular weight of 456.41 g/mol. Its IUPAC name is N-[[2-(3-methoxyphenoxy)-3-pyridinyl]methyl]-3-piperidin-4-ylbutanamide;dihydrochloride.
| Compound Name | N-[[2-(3-methoxyphenoxy)-3-pyridinyl]methyl]-3-piperidin-4-ylbutanamide;dihydrochloride |
|---|---|
| PubChem CID | 119892786 |
| Molecular Formula | C22H31Cl2N3O3 |
| Molecular Weight | 456.41 g/mol |
| Exact Mass | 455.17 |
| IUPAC Name | N-[[2-(3-methoxyphenoxy)-3-pyridinyl]methyl]-3-piperidin-4-ylbutanamide;dihydrochloride |
| SMILES | COc1cccc(Oc2ncccc2CNC(=O)CC(C)C2CCNCC2)c1.Cl.Cl |
| InChI | InChI=1S/C22H29N3O3.2ClH/c1-16(17-8-11-23-12-9-17)13-21(26)25-15-18-5-4-10-24-22(18)28-20-7-3-6-19(14-20)27-2;;/h3-7,10,14,16-17,23H,8-9,11-13,15H2,1-2H3,(H,25,26);2*1H |
| InChIKey | ZUTDXENAWJEAPX-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.41 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |