C18H26BrN3O — CID 119894332
(3-aminocyclopentyl)-[4-[1-(4-bromophenyl)ethyl]piperazin-1-yl]methanone (PubChem CID 119894332) has the molecular formula C18H26BrN3O and a molecular weight of 380.33 g/mol. Its IUPAC name is (3-aminocyclopentyl)-[4-[1-(4-bromophenyl)ethyl]piperazin-1-yl]methanone.
| Compound Name | (3-aminocyclopentyl)-[4-[1-(4-bromophenyl)ethyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 119894332 |
| Molecular Formula | C18H26BrN3O |
| Molecular Weight | 380.33 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | (3-aminocyclopentyl)-[4-[1-(4-bromophenyl)ethyl]piperazin-1-yl]methanone |
| SMILES | CC(c1ccc(Br)cc1)N1CCN(C(=O)C2CCC(N)C2)CC1 |
| InChI | InChI=1S/C18H26BrN3O/c1-13(14-2-5-16(19)6-3-14)21-8-10-22(11-9-21)18(23)15-4-7-17(20)12-15/h2-3,5-6,13,15,17H,4,7-12,20H2,1H3 |
| InChIKey | MFKZVKVGIDERSI-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.33 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |