C17H28Cl3N3O — CID 119894437
1-[4-[1-(4-chlorophenyl)ethyl]piperazin-1-yl]-4-(methylamino)butan-1-one;dihydrochloride (PubChem CID 119894437) has the molecular formula C17H28Cl3N3O and a molecular weight of 396.79 g/mol. Its IUPAC name is 1-[4-[1-(4-chlorophenyl)ethyl]piperazin-1-yl]-4-(methylamino)butan-1-one;dihydrochloride.
| Compound Name | 1-[4-[1-(4-chlorophenyl)ethyl]piperazin-1-yl]-4-(methylamino)butan-1-one;dihydrochloride |
|---|---|
| PubChem CID | 119894437 |
| Molecular Formula | C17H28Cl3N3O |
| Molecular Weight | 396.79 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | 1-[4-[1-(4-chlorophenyl)ethyl]piperazin-1-yl]-4-(methylamino)butan-1-one;dihydrochloride |
| SMILES | CNCCCC(=O)N1CCN(C(C)c2ccc(Cl)cc2)CC1.Cl.Cl |
| InChI | InChI=1S/C17H26ClN3O.2ClH/c1-14(15-5-7-16(18)8-6-15)20-10-12-21(13-11-20)17(22)4-3-9-19-2;;/h5-8,14,19H,3-4,9-13H2,1-2H3;2*1H |
| InChIKey | MAUBPAOUQFBFDR-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.79 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|