C19H24Cl3N3O — CID 119894463
(3-aminophenyl)-[4-[1-(4-chlorophenyl)ethyl]piperazin-1-yl]methanone;dihydrochloride (PubChem CID 119894463) has the molecular formula C19H24Cl3N3O and a molecular weight of 416.78 g/mol. Its IUPAC name is (3-aminophenyl)-[4-[1-(4-chlorophenyl)ethyl]piperazin-1-yl]methanone;dihydrochloride.
| Compound Name | (3-aminophenyl)-[4-[1-(4-chlorophenyl)ethyl]piperazin-1-yl]methanone;dihydrochloride |
|---|---|
| PubChem CID | 119894463 |
| Molecular Formula | C19H24Cl3N3O |
| Molecular Weight | 416.78 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | (3-aminophenyl)-[4-[1-(4-chlorophenyl)ethyl]piperazin-1-yl]methanone;dihydrochloride |
| SMILES | CC(c1ccc(Cl)cc1)N1CCN(C(=O)c2cccc(N)c2)CC1.Cl.Cl |
| InChI | InChI=1S/C19H22ClN3O.2ClH/c1-14(15-5-7-17(20)8-6-15)22-9-11-23(12-10-22)19(24)16-3-2-4-18(21)13-16;;/h2-8,13-14H,9-12,21H2,1H3;2*1H |
| InChIKey | FCRRAHSVONHXSO-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.78 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|