C25H31F3N4O2 — CID 11989466
1-[2-(dimethylamino)ethyl]-3-[[5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-3-yl]methyl]urea (PubChem CID 11989466) has the molecular formula C25H31F3N4O2 and a molecular weight of 476.54 g/mol. Its IUPAC name is 1-[2-(dimethylamino)ethyl]-3-[[5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-3-yl]methyl]urea.
| Compound Name | 1-[2-(dimethylamino)ethyl]-3-[[5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-3-yl]methyl]urea |
|---|---|
| PubChem CID | 11989466 |
| Molecular Formula | C25H31F3N4O2 |
| Molecular Weight | 476.54 g/mol |
| Exact Mass | 476.24 |
| IUPAC Name | 1-[2-(dimethylamino)ethyl]-3-[[5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-3-yl]methyl]urea |
| SMILES | CN(C)CCNC(=O)NCC1COC2c3cc(C(F)(F)F)ccc3NC(c3ccccc3)C2C1 |
| InChI | InChI=1S/C25H31F3N4O2/c1-32(2)11-10-29-24(33)30-14-16-12-20-22(17-6-4-3-5-7-17)31-21-9-8-18(25(26,27)28)13-19(21)23(20)34-15-16/h3-9,13,16,20,22-23,31H,10-12,14-15H2,1-2H3,(H2,29,30,33) |
| InChIKey | DADSIGWTQACBEQ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 65.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.54 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |