C23H26ClF3N2O3S — CID 11989467
3-chloro-N-[[5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-3-yl]methyl]propane-1-sulfonamide (PubChem CID 11989467) has the molecular formula C23H26ClF3N2O3S and a molecular weight of 502.99 g/mol. Its IUPAC name is 3-chloro-N-[[5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-3-yl]methyl]propane-1-sulfonamide.
| Compound Name | 3-chloro-N-[[5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-3-yl]methyl]propane-1-sulfonamide |
|---|---|
| PubChem CID | 11989467 |
| Molecular Formula | C23H26ClF3N2O3S |
| Molecular Weight | 502.99 g/mol |
| Exact Mass | 502.13 |
| IUPAC Name | 3-chloro-N-[[5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-3-yl]methyl]propane-1-sulfonamide |
| SMILES | O=S(=O)(CCCCl)NCC1COC2c3cc(C(F)(F)F)ccc3NC(c3ccccc3)C2C1 |
| InChI | InChI=1S/C23H26ClF3N2O3S/c24-9-4-10-33(30,31)28-13-15-11-19-21(16-5-2-1-3-6-16)29-20-8-7-17(23(25,26)27)12-18(20)22(19)32-14-15/h1-3,5-8,12,15,19,21-22,28-29H,4,9-11,13-14H2 |
| InChIKey | XAAUKFYBDYWBIH-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.99 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|