C20H35N3O2 — CID 119896456
3-amino-N-[[1-(morpholin-4-ylmethyl)cyclohexyl]methyl]bicyclo[2.2.1]heptane-2-carboxamide (PubChem CID 119896456) has the molecular formula C20H35N3O2 and a molecular weight of 349.52 g/mol. Its IUPAC name is 3-amino-N-[[1-(morpholin-4-ylmethyl)cyclohexyl]methyl]bicyclo[2.2.1]heptane-2-carboxamide.
| Compound Name | 3-amino-N-[[1-(morpholin-4-ylmethyl)cyclohexyl]methyl]bicyclo[2.2.1]heptane-2-carboxamide |
|---|---|
| PubChem CID | 119896456 |
| Molecular Formula | C20H35N3O2 |
| Molecular Weight | 349.52 g/mol |
| Exact Mass | 349.27 |
| IUPAC Name | 3-amino-N-[[1-(morpholin-4-ylmethyl)cyclohexyl]methyl]bicyclo[2.2.1]heptane-2-carboxamide |
| SMILES | NC1C2CCC(C2)C1C(=O)NCC1(CN2CCOCC2)CCCCC1 |
| InChI | InChI=1S/C20H35N3O2/c21-18-16-5-4-15(12-16)17(18)19(24)22-13-20(6-2-1-3-7-20)14-23-8-10-25-11-9-23/h15-18H,1-14,21H2,(H,22,24) |
| InChIKey | QGKANLVDWOFNPL-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.52 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |