C20H21F3N2O — CID 11989791
N-methyl-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-3-amine (PubChem CID 11989791) has the molecular formula C20H21F3N2O and a molecular weight of 362.40 g/mol. Its IUPAC name is N-methyl-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-3-amine.
| Compound Name | N-methyl-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-3-amine |
|---|---|
| PubChem CID | 11989791 |
| Molecular Formula | C20H21F3N2O |
| Molecular Weight | 362.40 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | N-methyl-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-3-amine |
| SMILES | CNC1COC2c3cc(C(F)(F)F)ccc3NC(c3ccccc3)C2C1 |
| InChI | InChI=1S/C20H21F3N2O/c1-24-14-10-16-18(12-5-3-2-4-6-12)25-17-8-7-13(20(21,22)23)9-15(17)19(16)26-11-14/h2-9,14,16,18-19,24-25H,10-11H2,1H3 |
| InChIKey | WAQZHYVUHVEBAD-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.40 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |