C22H24ClF3N2O3S — CID 11989794
3-chloro-N-[5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-3-yl]propane-1-sulfonamide (PubChem CID 11989794) has the molecular formula C22H24ClF3N2O3S and a molecular weight of 488.96 g/mol. Its IUPAC name is 3-chloro-N-[5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-3-yl]propane-1-sulfonamide.
| Compound Name | 3-chloro-N-[5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-3-yl]propane-1-sulfonamide |
|---|---|
| PubChem CID | 11989794 |
| Molecular Formula | C22H24ClF3N2O3S |
| Molecular Weight | 488.96 g/mol |
| Exact Mass | 488.11 |
| IUPAC Name | 3-chloro-N-[5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-3-yl]propane-1-sulfonamide |
| SMILES | O=S(=O)(CCCCl)NC1COC2c3cc(C(F)(F)F)ccc3NC(c3ccccc3)C2C1 |
| InChI | InChI=1S/C22H24ClF3N2O3S/c23-9-4-10-32(29,30)28-16-12-18-20(14-5-2-1-3-6-14)27-19-8-7-15(22(24,25)26)11-17(19)21(18)31-13-16/h1-3,5-8,11,16,18,20-21,27-28H,4,9-10,12-13H2 |
| InChIKey | NCFSXTIQCLGRCA-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.96 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|