C17H27N3O3 — CID 119898755
(2S)-2-amino-N-[[1-(3,5-dimethoxyphenyl)pyrrolidin-3-yl]methyl]butanamide (PubChem CID 119898755) has the molecular formula C17H27N3O3 and a molecular weight of 321.42 g/mol. Its IUPAC name is (2S)-2-amino-N-[[1-(3,5-dimethoxyphenyl)pyrrolidin-3-yl]methyl]butanamide.
| Compound Name | (2S)-2-amino-N-[[1-(3,5-dimethoxyphenyl)pyrrolidin-3-yl]methyl]butanamide |
|---|---|
| PubChem CID | 119898755 |
| Molecular Formula | C17H27N3O3 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.21 |
| IUPAC Name | (2S)-2-amino-N-[[1-(3,5-dimethoxyphenyl)pyrrolidin-3-yl]methyl]butanamide |
| SMILES | CC[C@H](N)C(=O)NCC1CCN(c2cc(OC)cc(OC)c2)C1 |
| InChI | InChI=1S/C17H27N3O3/c1-4-16(18)17(21)19-10-12-5-6-20(11-12)13-7-14(22-2)9-15(8-13)23-3/h7-9,12,16H,4-6,10-11,18H2,1-3H3,(H,19,21)/t12?,16-/m0/s1 |
| InChIKey | WKBNTQWFBKQKRN-INSVYWFGSA-N |
| XLogP | 1.38 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |