C28H42O6Si — CID 11989880
7-[(E)-4-[tert-butyl(dimethyl)silyl]oxybut-2-enyl]-6-(1-hydroxyhexyl)-2,5-dimethoxynaphthalene-1,4-dione (PubChem CID 11989880) has the molecular formula C28H42O6Si and a molecular weight of 502.72 g/mol. Its IUPAC name is 7-[(E)-4-[tert-butyl(dimethyl)silyl]oxybut-2-enyl]-6-(1-hydroxyhexyl)-2,5-dimethoxynaphthalene-1,4-dione.
| Compound Name | 7-[(E)-4-[tert-butyl(dimethyl)silyl]oxybut-2-enyl]-6-(1-hydroxyhexyl)-2,5-dimethoxynaphthalene-1,4-dione |
|---|---|
| PubChem CID | 11989880 |
| Molecular Formula | C28H42O6Si |
| Molecular Weight | 502.72 g/mol |
| Exact Mass | 502.28 |
| IUPAC Name | 7-[(E)-4-[tert-butyl(dimethyl)silyl]oxybut-2-enyl]-6-(1-hydroxyhexyl)-2,5-dimethoxynaphthalene-1,4-dione |
| SMILES | CCCCCC(O)c1c(C/C=C/CO[Si](C)(C)C(C)(C)C)cc2c(c1OC)C(=O)C=C(OC)C2=O |
| InChI | InChI=1S/C28H42O6Si/c1-9-10-11-15-21(29)24-19(14-12-13-16-34-35(7,8)28(2,3)4)17-20-25(27(24)33-6)22(30)18-23(32-5)26(20)31/h12-13,17-18,21,29H,9-11,14-16H2,1-8H3/b13-12+ |
| InChIKey | PLTAGBTYMIHNHV-OUKQBFOZSA-N |
| XLogP | 6.34 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.72 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|