About [6-[(2,6-dichlorophenyl)sulfanylmethyl]-2-pyridinyl]-(4-phenylpiperidin-1-yl)methanone
[6-[(2,6-dichlorophenyl)sulfanylmethyl]-2-pyridinyl]-(4-phenylpiperidin-1-yl)methanone (PubChem CID 11989979) has the molecular formula C24H22Cl2N2OS
and a molecular weight of 457.43 g/mol. Its IUPAC name is [6-[(2,6-dichlorophenyl)sulfanylmethyl]-2-pyridinyl]-(4-phenylpiperidin-1-yl)methanone.
Molecular Properties
| Compound Name | [6-[(2,6-dichlorophenyl)sulfanylmethyl]-2-pyridinyl]-(4-phenylpiperidin-1-yl)methanone |
| PubChem CID | 11989979 |
| Molecular Formula | C24H22Cl2N2OS |
| Molecular Weight | 457.43 g/mol |
| Exact Mass | 456.08 |
| IUPAC Name | [6-[(2,6-dichlorophenyl)sulfanylmethyl]-2-pyridinyl]-(4-phenylpiperidin-1-yl)methanone |
| SMILES | O=C(c1cccc(CSc2c(Cl)cccc2Cl)n1)N1CCC(c2ccccc2)CC1 |
| InChI | InChI=1S/C24H22Cl2N2OS/c25-20-9-5-10-21(26)23(20)30-16-19-8-4-11-22(27-19)24(29)28-14-12-18(13-15-28)17-6-2-1-3-7-17/h1-11,18H,12-16H2 |
| InChIKey | FCVXFCMLKHMGQX-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 457.43 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [6-[(2,6-dichlorophenyl)sulfanylmethyl]-2-pyridinyl]-(4-phenylpiperidin-1-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-[(2,6-dichlorophenyl)sulfanylmethyl]-2-pyridinyl]-(4-phenylpiperidin-1-yl)methanone?
The IUPAC name of [6-[(2,6-dichlorophenyl)sulfanylmethyl]-2-pyridinyl]-(4-phenylpiperidin-1-yl)methanone (CID 11989979) is [6-[(2,6-dichlorophenyl)sulfanylmethyl]-2-pyridinyl]-(4-phenylpiperidin-1-yl)methanone.
What is the SMILES notation for [6-[(2,6-dichlorophenyl)sulfanylmethyl]-2-pyridinyl]-(4-phenylpiperidin-1-yl)methanone?
The canonical SMILES for [6-[(2,6-dichlorophenyl)sulfanylmethyl]-2-pyridinyl]-(4-phenylpiperidin-1-yl)methanone is O=C(c1cccc(CSc2c(Cl)cccc2Cl)n1)N1CCC(c2ccccc2)CC1.
What is the InChIKey of [6-[(2,6-dichlorophenyl)sulfanylmethyl]-2-pyridinyl]-(4-phenylpiperidin-1-yl)methanone?
The InChIKey is FCVXFCMLKHMGQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H22Cl2N2OS/c25-20-9-5-10-21(26)23(20)30-16-19-8-4-11-22(27-19)24(29)28-14-12-18(13-15-28)17-6-2-1-3-7-17/h1-11,18H,12-16H2.
What are the key properties of [6-[(2,6-dichlorophenyl)sulfanylmethyl]-2-pyridinyl]-(4-phenylpiperidin-1-yl)methanone?
[6-[(2,6-dichlorophenyl)sulfanylmethyl]-2-pyridinyl]-(4-phenylpiperidin-1-yl)methanone has a molecular weight of 457.43 g/mol, XLogP of 6.70, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [6-[(2,6-dichlorophenyl)sulfanylmethyl]-2-pyridinyl]-(4-phenylpiperidin-1-yl)methanone is sourced from PubChem (CID 11989979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).