About morpholin-2-yl-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]methanone
morpholin-2-yl-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]methanone (PubChem CID 119899931) has the molecular formula C12H20F3N3O2
and a molecular weight of 295.31 g/mol. Its IUPAC name is morpholin-2-yl-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]methanone.
Molecular Properties
| Compound Name | morpholin-2-yl-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]methanone |
| PubChem CID | 119899931 |
| Molecular Formula | C12H20F3N3O2 |
| Molecular Weight | 295.31 g/mol |
| Exact Mass | 295.15 |
| IUPAC Name | morpholin-2-yl-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]methanone |
| SMILES | CC(N1CCN(C(=O)C2CNCCO2)CC1)C(F)(F)F |
| InChI | InChI=1S/C12H20F3N3O2/c1-9(12(13,14)15)17-3-5-18(6-4-17)11(19)10-8-16-2-7-20-10/h9-10,16H,2-8H2,1H3 |
| InChIKey | UDHJTHDCNLFJQF-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.31 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze morpholin-2-yl-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of morpholin-2-yl-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]methanone?
The IUPAC name of morpholin-2-yl-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]methanone (CID 119899931) is morpholin-2-yl-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]methanone.
What is the SMILES notation for morpholin-2-yl-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]methanone?
The canonical SMILES for morpholin-2-yl-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]methanone is CC(N1CCN(C(=O)C2CNCCO2)CC1)C(F)(F)F.
What is the InChIKey of morpholin-2-yl-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]methanone?
The InChIKey is UDHJTHDCNLFJQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20F3N3O2/c1-9(12(13,14)15)17-3-5-18(6-4-17)11(19)10-8-16-2-7-20-10/h9-10,16H,2-8H2,1H3.
What are the key properties of morpholin-2-yl-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]methanone?
morpholin-2-yl-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]methanone has a molecular weight of 295.31 g/mol, XLogP of 0.07, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for morpholin-2-yl-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]methanone is sourced from PubChem (CID 119899931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).