About benzene-1,2-diamine;dihydrochloride
benzene-1,2-diamine;dihydrochloride (PubChem CID 11990) has the molecular formula C6H10Cl2N2
and a molecular weight of 181.07 g/mol. Its IUPAC name is benzene-1,2-diamine;dihydrochloride.
Molecular Properties
| Compound Name | benzene-1,2-diamine;dihydrochloride |
| PubChem CID | 11990 |
| Molecular Formula | C6H10Cl2N2 |
| Molecular Weight | 181.07 g/mol |
| Exact Mass | 180.02 |
| IUPAC Name | benzene-1,2-diamine;dihydrochloride |
| SMILES | Cl.Cl.Nc1ccccc1N |
| InChI | InChI=1S/C6H8N2.2ClH/c7-5-3-1-2-4-6(5)8;;/h1-4H,7-8H2;2*1H |
| InChIKey | RIIWUGSYXOBDMC-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.07 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze benzene-1,2-diamine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene-1,2-diamine;dihydrochloride?
The IUPAC name of benzene-1,2-diamine;dihydrochloride (CID 11990) is benzene-1,2-diamine;dihydrochloride.
What is the SMILES notation for benzene-1,2-diamine;dihydrochloride?
The canonical SMILES for benzene-1,2-diamine;dihydrochloride is Cl.Cl.Nc1ccccc1N.
What is the InChIKey of benzene-1,2-diamine;dihydrochloride?
The InChIKey is RIIWUGSYXOBDMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2.2ClH/c7-5-3-1-2-4-6(5)8;;/h1-4H,7-8H2;2*1H.
What are the key properties of benzene-1,2-diamine;dihydrochloride?
benzene-1,2-diamine;dihydrochloride has a molecular weight of 181.07 g/mol, XLogP of 1.69, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzene-1,2-diamine;dihydrochloride is sourced from PubChem (CID 11990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).