C16H26Cl3N3O2 — CID 119900701
N-[2-[(3-chloro-2-pyridinyl)oxy]ethyl]-3-piperidin-3-ylbutanamide;dihydrochloride (PubChem CID 119900701) has the molecular formula C16H26Cl3N3O2 and a molecular weight of 398.76 g/mol. Its IUPAC name is N-[2-[(3-chloro-2-pyridinyl)oxy]ethyl]-3-piperidin-3-ylbutanamide;dihydrochloride.
| Compound Name | N-[2-[(3-chloro-2-pyridinyl)oxy]ethyl]-3-piperidin-3-ylbutanamide;dihydrochloride |
|---|---|
| PubChem CID | 119900701 |
| Molecular Formula | C16H26Cl3N3O2 |
| Molecular Weight | 398.76 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | N-[2-[(3-chloro-2-pyridinyl)oxy]ethyl]-3-piperidin-3-ylbutanamide;dihydrochloride |
| SMILES | CC(CC(=O)NCCOc1ncccc1Cl)C1CCCNC1.Cl.Cl |
| InChI | InChI=1S/C16H24ClN3O2.2ClH/c1-12(13-4-2-6-18-11-13)10-15(21)19-8-9-22-16-14(17)5-3-7-20-16;;/h3,5,7,12-13,18H,2,4,6,8-11H2,1H3,(H,19,21);2*1H |
| InChIKey | LTQZOIVVCGMMKT-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.76 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|