C18H39Cl3N4O — CID 119901725
N-[2-(4-ethylpiperazin-1-yl)propyl]-3-piperidin-3-ylbutanamide;trihydrochloride (PubChem CID 119901725) has the molecular formula C18H39Cl3N4O and a molecular weight of 433.90 g/mol. Its IUPAC name is N-[2-(4-ethylpiperazin-1-yl)propyl]-3-piperidin-3-ylbutanamide;trihydrochloride.
| Compound Name | N-[2-(4-ethylpiperazin-1-yl)propyl]-3-piperidin-3-ylbutanamide;trihydrochloride |
|---|---|
| PubChem CID | 119901725 |
| Molecular Formula | C18H39Cl3N4O |
| Molecular Weight | 433.90 g/mol |
| Exact Mass | 432.22 |
| IUPAC Name | N-[2-(4-ethylpiperazin-1-yl)propyl]-3-piperidin-3-ylbutanamide;trihydrochloride |
| SMILES | CCN1CCN(C(C)CNC(=O)CC(C)C2CCCNC2)CC1.Cl.Cl.Cl |
| InChI | InChI=1S/C18H36N4O.3ClH/c1-4-21-8-10-22(11-9-21)16(3)13-20-18(23)12-15(2)17-6-5-7-19-14-17;;;/h15-17,19H,4-14H2,1-3H3,(H,20,23);3*1H |
| InChIKey | SZWLEGPXXPOFAZ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.90 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |