C16H25N5O — CID 119902780
N-[[2-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]pyrrolidine-3-carboxamide (PubChem CID 119902780) has the molecular formula C16H25N5O and a molecular weight of 303.41 g/mol. Its IUPAC name is N-[[2-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]pyrrolidine-3-carboxamide.
| Compound Name | N-[[2-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 119902780 |
| Molecular Formula | C16H25N5O |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.21 |
| IUPAC Name | N-[[2-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]pyrrolidine-3-carboxamide |
| SMILES | CN1CCN(c2ncccc2CNC(=O)C2CCNC2)CC1 |
| InChI | InChI=1S/C16H25N5O/c1-20-7-9-21(10-8-20)15-13(3-2-5-18-15)12-19-16(22)14-4-6-17-11-14/h2-3,5,14,17H,4,6-12H2,1H3,(H,19,22) |
| InChIKey | DEHRUJLNMYQJFT-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 60.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |