C17H26N4O — CID 119903379
1-amino-N-methyl-N-[2-(4-phenylpiperazin-1-yl)ethyl]cyclopropane-1-carboxamide (PubChem CID 119903379) has the molecular formula C17H26N4O and a molecular weight of 302.42 g/mol. Its IUPAC name is 1-amino-N-methyl-N-[2-(4-phenylpiperazin-1-yl)ethyl]cyclopropane-1-carboxamide.
| Compound Name | 1-amino-N-methyl-N-[2-(4-phenylpiperazin-1-yl)ethyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 119903379 |
| Molecular Formula | C17H26N4O |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.21 |
| IUPAC Name | 1-amino-N-methyl-N-[2-(4-phenylpiperazin-1-yl)ethyl]cyclopropane-1-carboxamide |
| SMILES | CN(CCN1CCN(c2ccccc2)CC1)C(=O)C1(N)CC1 |
| InChI | InChI=1S/C17H26N4O/c1-19(16(22)17(18)7-8-17)9-10-20-11-13-21(14-12-20)15-5-3-2-4-6-15/h2-6H,7-14,18H2,1H3 |
| InChIKey | FQAAISPGSIVSMW-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 52.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |