C27H33NO5 — CID 11990434
2-[3-[[2-(3,4-dimethylphenyl)-5-propan-2-yl-1,3-oxazol-4-yl]methoxy]propoxymethyl]-6-methylbenzoic acid (PubChem CID 11990434) has the molecular formula C27H33NO5 and a molecular weight of 451.56 g/mol. Its IUPAC name is 2-[3-[[2-(3,4-dimethylphenyl)-5-propan-2-yl-1,3-oxazol-4-yl]methoxy]propoxymethyl]-6-methylbenzoic acid.
| Compound Name | 2-[3-[[2-(3,4-dimethylphenyl)-5-propan-2-yl-1,3-oxazol-4-yl]methoxy]propoxymethyl]-6-methylbenzoic acid |
|---|---|
| PubChem CID | 11990434 |
| Molecular Formula | C27H33NO5 |
| Molecular Weight | 451.56 g/mol |
| Exact Mass | 451.24 |
| IUPAC Name | 2-[3-[[2-(3,4-dimethylphenyl)-5-propan-2-yl-1,3-oxazol-4-yl]methoxy]propoxymethyl]-6-methylbenzoic acid |
| SMILES | Cc1ccc(-c2nc(COCCCOCc3cccc(C)c3C(=O)O)c(C(C)C)o2)cc1C |
| InChI | InChI=1S/C27H33NO5/c1-17(2)25-23(28-26(33-25)21-11-10-18(3)20(5)14-21)16-32-13-7-12-31-15-22-9-6-8-19(4)24(22)27(29)30/h6,8-11,14,17H,7,12-13,15-16H2,1-5H3,(H,29,30) |
| InChIKey | XGPCHJWAUZQQST-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 81.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.56 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|