C17H25ClN2O3 — CID 119904711
1-[2-[benzyl(propan-2-yl)amino]-2-oxoethyl]pyrrolidine-3-carboxylic acid;hydrochloride (PubChem CID 119904711) has the molecular formula C17H25ClN2O3 and a molecular weight of 340.85 g/mol. Its IUPAC name is 1-[2-[benzyl(propan-2-yl)amino]-2-oxoethyl]pyrrolidine-3-carboxylic acid;hydrochloride.
| Compound Name | 1-[2-[benzyl(propan-2-yl)amino]-2-oxoethyl]pyrrolidine-3-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 119904711 |
| Molecular Formula | C17H25ClN2O3 |
| Molecular Weight | 340.85 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | 1-[2-[benzyl(propan-2-yl)amino]-2-oxoethyl]pyrrolidine-3-carboxylic acid;hydrochloride |
| SMILES | CC(C)N(Cc1ccccc1)C(=O)CN1CCC(C(=O)O)C1.Cl |
| InChI | InChI=1S/C17H24N2O3.ClH/c1-13(2)19(10-14-6-4-3-5-7-14)16(20)12-18-9-8-15(11-18)17(21)22;/h3-7,13,15H,8-12H2,1-2H3,(H,21,22);1H |
| InChIKey | VZWFZLCNPJTYFV-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.85 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |