C12H23ClN4O2 — CID 119905154
1-[2-[(3R)-3-aminopyrrolidin-1-yl]acetyl]piperidine-3-carboxamide;hydrochloride (PubChem CID 119905154) has the molecular formula C12H23ClN4O2 and a molecular weight of 290.80 g/mol. Its IUPAC name is 1-[2-[(3R)-3-aminopyrrolidin-1-yl]acetyl]piperidine-3-carboxamide;hydrochloride.
| Compound Name | 1-[2-[(3R)-3-aminopyrrolidin-1-yl]acetyl]piperidine-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119905154 |
| Molecular Formula | C12H23ClN4O2 |
| Molecular Weight | 290.80 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | 1-[2-[(3R)-3-aminopyrrolidin-1-yl]acetyl]piperidine-3-carboxamide;hydrochloride |
| SMILES | Cl.NC(=O)C1CCCN(C(=O)CN2CC[C@@H](N)C2)C1 |
| InChI | InChI=1S/C12H22N4O2.ClH/c13-10-3-5-15(7-10)8-11(17)16-4-1-2-9(6-16)12(14)18;/h9-10H,1-8,13H2,(H2,14,18);1H/t9?,10-;/m1./s1 |
| InChIKey | IJUNINBAYWABJT-FJYJDOHQSA-N |
| XLogP | -0.83 |
| TPSA | 92.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.80 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |