C11H14BrClN2 — CID 119905432
(3R)-1-[(2-bromo-4-chlorophenyl)methyl]pyrrolidin-3-amine (PubChem CID 119905432) has the molecular formula C11H14BrClN2 and a molecular weight of 289.60 g/mol. Its IUPAC name is (3R)-1-[(2-bromo-4-chlorophenyl)methyl]pyrrolidin-3-amine.
| Compound Name | (3R)-1-[(2-bromo-4-chlorophenyl)methyl]pyrrolidin-3-amine |
|---|---|
| PubChem CID | 119905432 |
| Molecular Formula | C11H14BrClN2 |
| Molecular Weight | 289.60 g/mol |
| Exact Mass | 288.00 |
| IUPAC Name | (3R)-1-[(2-bromo-4-chlorophenyl)methyl]pyrrolidin-3-amine |
| SMILES | N[C@@H]1CCN(Cc2ccc(Cl)cc2Br)C1 |
| InChI | InChI=1S/C11H14BrClN2/c12-11-5-9(13)2-1-8(11)6-15-4-3-10(14)7-15/h1-2,5,10H,3-4,6-7,14H2/t10-/m1/s1 |
| InChIKey | XIEISYNAIXNCJV-SNVBAGLBSA-N |
| XLogP | 2.64 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.60 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |