C28H28Cl2F4N4O5 — CID 11990619
2-[(2R,6S)-4-[3-[(2,4-dichlorophenyl)methylcarbamoyl]-6-fluoro-8-methoxy-4-oxo-1-(2,2,2-trifluoroethyl)quinolin-7-yl]-2,6-dimethylpiperazin-1-yl]acetic acid (PubChem CID 11990619) has the molecular formula C28H28Cl2F4N4O5 and a molecular weight of 647.45 g/mol. Its IUPAC name is 2-[(2R,6S)-4-[3-[(2,4-dichlorophenyl)methylcarbamoyl]-6-fluoro-8-methoxy-4-oxo-1-(2,2,2-trifluoroethyl)quinolin-7-yl]-2,6-dimethylpiperazin-1-yl]acetic acid.
| Compound Name | 2-[(2R,6S)-4-[3-[(2,4-dichlorophenyl)methylcarbamoyl]-6-fluoro-8-methoxy-4-oxo-1-(2,2,2-trifluoroethyl)quinolin-7-yl]-2,6-dimethylpiperazin-1-yl]acetic acid |
|---|---|
| PubChem CID | 11990619 |
| Molecular Formula | C28H28Cl2F4N4O5 |
| Molecular Weight | 647.45 g/mol |
| Exact Mass | 646.14 |
| IUPAC Name | 2-[(2R,6S)-4-[3-[(2,4-dichlorophenyl)methylcarbamoyl]-6-fluoro-8-methoxy-4-oxo-1-(2,2,2-trifluoroethyl)quinolin-7-yl]-2,6-dimethylpiperazin-1-yl]acetic acid |
| SMILES | COc1c(N2C[C@@H](C)N(CC(=O)O)[C@@H](C)C2)c(F)cc2c(=O)c(C(=O)NCc3ccc(Cl)cc3Cl)cn(CC(F)(F)F)c12 |
| InChI | InChI=1S/C28H28Cl2F4N4O5/c1-14-9-36(10-15(2)38(14)12-22(39)40)24-21(31)7-18-23(26(24)43-3)37(13-28(32,33)34)11-19(25(18)41)27(42)35-8-16-4-5-17(29)6-20(16)30/h4-7,11,14-15H,8-10,12-13H2,1-3H3,(H,35,42)(H,39,40)/t14-,15+ |
| InChIKey | AJCDASWVBLHRRM-GASCZTMLSA-N |
| XLogP | 4.93 |
| TPSA | 104.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.45 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |