C14H21ClN4O3 — CID 119906424
2-(1,4-diazepan-1-yl)-N-methyl-N-(4-nitrophenyl)acetamide;hydrochloride (PubChem CID 119906424) has the molecular formula C14H21ClN4O3 and a molecular weight of 328.80 g/mol. Its IUPAC name is 2-(1,4-diazepan-1-yl)-N-methyl-N-(4-nitrophenyl)acetamide;hydrochloride.
| Compound Name | 2-(1,4-diazepan-1-yl)-N-methyl-N-(4-nitrophenyl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119906424 |
| Molecular Formula | C14H21ClN4O3 |
| Molecular Weight | 328.80 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | 2-(1,4-diazepan-1-yl)-N-methyl-N-(4-nitrophenyl)acetamide;hydrochloride |
| SMILES | CN(C(=O)CN1CCCNCC1)c1ccc([N+](=O)[O-])cc1.Cl |
| InChI | InChI=1S/C14H20N4O3.ClH/c1-16(12-3-5-13(6-4-12)18(20)21)14(19)11-17-9-2-7-15-8-10-17;/h3-6,15H,2,7-11H2,1H3;1H |
| InChIKey | VKVFPOCZXZPJGQ-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 78.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.80 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|