C17H25ClN2O4 — CID 119906958
1-[1-(4-ethoxyanilino)-1-oxopropan-2-yl]piperidine-4-carboxylic acid;hydrochloride (PubChem CID 119906958) has the molecular formula C17H25ClN2O4 and a molecular weight of 356.85 g/mol. Its IUPAC name is 1-[1-(4-ethoxyanilino)-1-oxopropan-2-yl]piperidine-4-carboxylic acid;hydrochloride.
| Compound Name | 1-[1-(4-ethoxyanilino)-1-oxopropan-2-yl]piperidine-4-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 119906958 |
| Molecular Formula | C17H25ClN2O4 |
| Molecular Weight | 356.85 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | 1-[1-(4-ethoxyanilino)-1-oxopropan-2-yl]piperidine-4-carboxylic acid;hydrochloride |
| SMILES | CCOc1ccc(NC(=O)C(C)N2CCC(C(=O)O)CC2)cc1.Cl |
| InChI | InChI=1S/C17H24N2O4.ClH/c1-3-23-15-6-4-14(5-7-15)18-16(20)12(2)19-10-8-13(9-11-19)17(21)22;/h4-7,12-13H,3,8-11H2,1-2H3,(H,18,20)(H,21,22);1H |
| InChIKey | HSXAMNMCWYORJO-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.85 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |