C16H27ClN2 — CID 119907556
1-[[4-(2-methylpropyl)phenyl]methyl]piperidin-4-amine;hydrochloride (PubChem CID 119907556) has the molecular formula C16H27ClN2 and a molecular weight of 282.86 g/mol. Its IUPAC name is 1-[[4-(2-methylpropyl)phenyl]methyl]piperidin-4-amine;hydrochloride.
| Compound Name | 1-[[4-(2-methylpropyl)phenyl]methyl]piperidin-4-amine;hydrochloride |
|---|---|
| PubChem CID | 119907556 |
| Molecular Formula | C16H27ClN2 |
| Molecular Weight | 282.86 g/mol |
| Exact Mass | 282.19 |
| IUPAC Name | 1-[[4-(2-methylpropyl)phenyl]methyl]piperidin-4-amine;hydrochloride |
| SMILES | CC(C)Cc1ccc(CN2CCC(N)CC2)cc1.Cl |
| InChI | InChI=1S/C16H26N2.ClH/c1-13(2)11-14-3-5-15(6-4-14)12-18-9-7-16(17)8-10-18;/h3-6,13,16H,7-12,17H2,1-2H3;1H |
| InChIKey | LUHSKDWLACIFQB-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.86 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |