C20H20N4 — CID 11990813
3,4,13,14-tetramethyl-2,5,12,15-tetrazatricyclo[14.4.0.06,11]icosa-1,3,5,7,9,11,13,15,17,19-decaene (PubChem CID 11990813) has the molecular formula C20H20N4 and a molecular weight of 316.41 g/mol. Its IUPAC name is 3,4,13,14-tetramethyl-2,5,12,15-tetrazatricyclo[14.4.0.06,11]icosa-1,3,5,7,9,11,13,15,17,19-decaene.
| Compound Name | 3,4,13,14-tetramethyl-2,5,12,15-tetrazatricyclo[14.4.0.06,11]icosa-1,3,5,7,9,11,13,15,17,19-decaene |
|---|---|
| PubChem CID | 11990813 |
| Molecular Formula | C20H20N4 |
| Molecular Weight | 316.41 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | 3,4,13,14-tetramethyl-2,5,12,15-tetrazatricyclo[14.4.0.06,11]icosa-1,3,5,7,9,11,13,15,17,19-decaene |
| SMILES | CC1=C(C)/N=c2/cccc/c2=N\C(C)=C(C)/N=c2\cccc\c2=N\1 |
| InChI | InChI=1S/C20H20N4/c1-13-14(2)22-19-11-7-8-12-20(19)24-16(4)15(3)23-18-10-6-5-9-17(18)21-13/h5-12H,1-4H3/b14-13?,16-15?,21-13?,21-17-,22-14?,22-19-,23-15?,23-18+,24-16?,24-20+ |
| InChIKey | QDWVCPIOFHVDDS-RRVHFSAYSA-N |
| XLogP | 2.38 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.41 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |